C24H32O6 — CID 125416430
7-[(2E,5E,7S,10R)-7,10,11-trihydroxy-3,7,11-trimethyldodeca-2,5-dienoxy]chromen-2-one (PubChem CID 125416430) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is 7-[(2E,5E,7S,10R)-7,10,11-trihydroxy-3,7,11-trimethyldodeca-2,5-dienoxy]chromen-2-one.
| Compound Name | 7-[(2E,5E,7S,10R)-7,10,11-trihydroxy-3,7,11-trimethyldodeca-2,5-dienoxy]chromen-2-one |
|---|---|
| PubChem CID | 125416430 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 7-[(2E,5E,7S,10R)-7,10,11-trihydroxy-3,7,11-trimethyldodeca-2,5-dienoxy]chromen-2-one |
| SMILES | C/C(=C\COc1ccc2ccc(=O)oc2c1)C/C=C/[C@@](C)(O)CC[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C24H32O6/c1-17(6-5-13-24(4,28)14-11-21(25)23(2,3)27)12-15-29-19-9-7-18-8-10-22(26)30-20(18)16-19/h5,7-10,12-13,16,21,25,27-28H,6,11,14-15H2,1-4H3/b13-5+,17-12+/t21-,24-/m1/s1 |
| InChIKey | NZEJTWMPBBOFLP-KTCIFXGCSA-N |
| XLogP | 3.73 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|