C21H28O5 — CID 129316808
7-(7-ethoxy-6-hydroxy-3,7-dimethyloct-2-enoxy)chromen-2-one (PubChem CID 129316808) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 7-(7-ethoxy-6-hydroxy-3,7-dimethyloct-2-enoxy)chromen-2-one.
| Compound Name | 7-(7-ethoxy-6-hydroxy-3,7-dimethyloct-2-enoxy)chromen-2-one |
|---|---|
| PubChem CID | 129316808 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 7-(7-ethoxy-6-hydroxy-3,7-dimethyloct-2-enoxy)chromen-2-one |
| SMILES | CCOC(C)(C)C(O)CCC(C)=CCOc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C21H28O5/c1-5-25-21(3,4)19(22)10-6-15(2)12-13-24-17-9-7-16-8-11-20(23)26-18(16)14-17/h7-9,11-12,14,19,22H,5-6,10,13H2,1-4H3 |
| InChIKey | FEQHBHHTIGJGNR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|