C33H36O6 — CID 145196276
7-[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one;7-(3-methylbut-2-enoxy)chromen-2-one (PubChem CID 145196276) has the molecular formula C33H36O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one;7-(3-methylbut-2-enoxy)chromen-2-one.
| Compound Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one;7-(3-methylbut-2-enoxy)chromen-2-one |
|---|---|
| PubChem CID | 145196276 |
| Molecular Formula | C33H36O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]chromen-2-one;7-(3-methylbut-2-enoxy)chromen-2-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc2ccc(=O)oc2c1.CC(C)=CCOc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C19H22O3.C14H14O3/c1-14(2)5-4-6-15(3)11-12-21-17-9-7-16-8-10-19(20)22-18(16)13-17;1-10(2)7-8-16-12-5-3-11-4-6-14(15)17-13(11)9-12/h5,7-11,13H,4,6,12H2,1-3H3;3-7,9H,8H2,1-2H3/b15-11+; |
| InChIKey | ALOWCOFHQBNUEG-KRWCAOSLSA-N |
| XLogP | 8.00 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|