C24H32O5 — CID 122369880
7-[(E)-5-[(1S,3S,4S)-3,4-dihydroxy-2,2,4-trimethylcyclohexyl]-3-methylpent-2-enoxy]chromen-2-one (PubChem CID 122369880) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 7-[(E)-5-[(1S,3S,4S)-3,4-dihydroxy-2,2,4-trimethylcyclohexyl]-3-methylpent-2-enoxy]chromen-2-one.
| Compound Name | 7-[(E)-5-[(1S,3S,4S)-3,4-dihydroxy-2,2,4-trimethylcyclohexyl]-3-methylpent-2-enoxy]chromen-2-one |
|---|---|
| PubChem CID | 122369880 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 7-[(E)-5-[(1S,3S,4S)-3,4-dihydroxy-2,2,4-trimethylcyclohexyl]-3-methylpent-2-enoxy]chromen-2-one |
| SMILES | C/C(=C\COc1ccc2ccc(=O)oc2c1)CC[C@H]1CC[C@](C)(O)[C@@H](O)C1(C)C |
| InChI | InChI=1S/C24H32O5/c1-16(5-8-18-11-13-24(4,27)22(26)23(18,2)3)12-14-28-19-9-6-17-7-10-21(25)29-20(17)15-19/h6-7,9-10,12,15,18,22,26-27H,5,8,11,13-14H2,1-4H3/b16-12+/t18-,22-,24-/m0/s1 |
| InChIKey | RXQJPYLFNPQMNP-RSNOSLHSSA-N |
| XLogP | 4.45 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|