C24H32O5 — CID 162934463
7-[5-[(1R,3S,6R)-3,6-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpent-2-enoxy]chromen-2-one (PubChem CID 162934463) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 7-[5-[(1R,3S,6R)-3,6-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpent-2-enoxy]chromen-2-one.
| Compound Name | 7-[5-[(1R,3S,6R)-3,6-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpent-2-enoxy]chromen-2-one |
|---|---|
| PubChem CID | 162934463 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 7-[5-[(1R,3S,6R)-3,6-dihydroxy-2,2,6-trimethylcyclohexyl]-3-methylpent-2-enoxy]chromen-2-one |
| SMILES | CC(=CCOc1ccc2ccc(=O)oc2c1)CC[C@@H]1C(C)(C)[C@@H](O)CC[C@@]1(C)O |
| InChI | InChI=1S/C24H32O5/c1-16(5-9-20-23(2,3)21(25)11-13-24(20,4)27)12-14-28-18-8-6-17-7-10-22(26)29-19(17)15-18/h6-8,10,12,15,20-21,25,27H,5,9,11,13-14H2,1-4H3/t20-,21+,24-/m1/s1 |
| InChIKey | HBYBDKQFQLMBGU-ZFGGDYGUSA-N |
| XLogP | 4.45 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|