C24H34O6 — CID 162940368
7-[(3R)-5-[(1R,3S,6S)-3,6-dihydroxy-2,2,6-trimethylcyclohexyl]-3-hydroxy-3-methylpentoxy]chromen-2-one (PubChem CID 162940368) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is 7-[(3R)-5-[(1R,3S,6S)-3,6-dihydroxy-2,2,6-trimethylcyclohexyl]-3-hydroxy-3-methylpentoxy]chromen-2-one.
| Compound Name | 7-[(3R)-5-[(1R,3S,6S)-3,6-dihydroxy-2,2,6-trimethylcyclohexyl]-3-hydroxy-3-methylpentoxy]chromen-2-one |
|---|---|
| PubChem CID | 162940368 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 7-[(3R)-5-[(1R,3S,6S)-3,6-dihydroxy-2,2,6-trimethylcyclohexyl]-3-hydroxy-3-methylpentoxy]chromen-2-one |
| SMILES | CC1(C)[C@@H](CC[C@@](C)(O)CCOc2ccc3ccc(=O)oc3c2)[C@@](C)(O)CC[C@@H]1O |
| InChI | InChI=1S/C24H34O6/c1-22(2)19(24(4,28)12-10-20(22)25)9-11-23(3,27)13-14-29-17-7-5-16-6-8-21(26)30-18(16)15-17/h5-8,15,19-20,25,27-28H,9-14H2,1-4H3/t19-,20+,23-,24+/m1/s1 |
| InChIKey | SKOQTSGTXDUTPI-JDBUVZGPSA-N |
| XLogP | 3.64 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|