C15H16O4 — CID 58868616
7-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethoxy]chromen-2-one (PubChem CID 58868616) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 7-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethoxy]chromen-2-one.
| Compound Name | 7-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethoxy]chromen-2-one |
|---|---|
| PubChem CID | 58868616 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 7-[2-[(2R)-3,3-dimethyloxiran-2-yl]ethoxy]chromen-2-one |
| SMILES | CC1(C)O[C@@H]1CCOc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C15H16O4/c1-15(2)13(19-15)7-8-17-11-5-3-10-4-6-14(16)18-12(10)9-11/h3-6,9,13H,7-8H2,1-2H3/t13-/m1/s1 |
| InChIKey | UYKVPGQLQDATRH-CYBMUJFWSA-N |
| XLogP | 2.74 |
| TPSA | 51.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|