C19H24O4 — CID 85108316
7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpentoxy]chromen-2-one (PubChem CID 85108316) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpentoxy]chromen-2-one.
| Compound Name | 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpentoxy]chromen-2-one |
|---|---|
| PubChem CID | 85108316 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 7-[5-(3,3-dimethyloxiran-2-yl)-3-methylpentoxy]chromen-2-one |
| SMILES | CC(CCOc1ccc2ccc(=O)oc2c1)CCC1OC1(C)C |
| InChI | InChI=1S/C19H24O4/c1-13(4-8-17-19(2,3)23-17)10-11-21-15-7-5-14-6-9-18(20)22-16(14)12-15/h5-7,9,12-13,17H,4,8,10-11H2,1-3H3 |
| InChIKey | QHSJJRWNDFOCTK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|