C13H16O11P2 — CID 58868552
[4-(2-oxochromen-7-yl)oxy-1-phosphonooxybutan-2-yl] dihydrogen phosphate (PubChem CID 58868552) has the molecular formula C13H16O11P2 and a molecular weight of 410.21 g/mol. Its IUPAC name is [4-(2-oxochromen-7-yl)oxy-1-phosphonooxybutan-2-yl] dihydrogen phosphate.
| Compound Name | [4-(2-oxochromen-7-yl)oxy-1-phosphonooxybutan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58868552 |
| Molecular Formula | C13H16O11P2 |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | [4-(2-oxochromen-7-yl)oxy-1-phosphonooxybutan-2-yl] dihydrogen phosphate |
| SMILES | O=c1ccc2ccc(OCCC(COP(=O)(O)O)OP(=O)(O)O)cc2o1 |
| InChI | InChI=1S/C13H16O11P2/c14-13-4-2-9-1-3-10(7-12(9)23-13)21-6-5-11(24-26(18,19)20)8-22-25(15,16)17/h1-4,7,11H,5-6,8H2,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | TUBOJSOQOHRZKM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 172.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|