C15H17NO5 — CID 58868501
N-[2-hydroxy-4-(2-oxochromen-7-yl)oxybutyl]acetamide (PubChem CID 58868501) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is N-[2-hydroxy-4-(2-oxochromen-7-yl)oxybutyl]acetamide.
| Compound Name | N-[2-hydroxy-4-(2-oxochromen-7-yl)oxybutyl]acetamide |
|---|---|
| PubChem CID | 58868501 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[2-hydroxy-4-(2-oxochromen-7-yl)oxybutyl]acetamide |
| SMILES | CC(=O)NCC(O)CCOc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C15H17NO5/c1-10(17)16-9-12(18)6-7-20-13-4-2-11-3-5-15(19)21-14(11)8-13/h2-5,8,12,18H,6-7,9H2,1H3,(H,16,17) |
| InChIKey | LLICPSZDSXUCAJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|