C17H21NO5 — CID 87516805
N-[(2R)-1-hydroxy-5-(2-oxochromen-7-yl)oxypentan-2-yl]propanamide (PubChem CID 87516805) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[(2R)-1-hydroxy-5-(2-oxochromen-7-yl)oxypentan-2-yl]propanamide.
| Compound Name | N-[(2R)-1-hydroxy-5-(2-oxochromen-7-yl)oxypentan-2-yl]propanamide |
|---|---|
| PubChem CID | 87516805 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[(2R)-1-hydroxy-5-(2-oxochromen-7-yl)oxypentan-2-yl]propanamide |
| SMILES | CCC(=O)N[C@@H](CO)CCCOc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C17H21NO5/c1-2-16(20)18-13(11-19)4-3-9-22-14-7-5-12-6-8-17(21)23-15(12)10-14/h5-8,10,13,19H,2-4,9,11H2,1H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | YAOAWUXCBXQSIJ-CYBMUJFWSA-N |
| XLogP | 1.84 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|