C19H22O4 — CID 102247134
7-(3,7-dimethyl-5-oxooct-6-enoxy)chromen-2-one (PubChem CID 102247134) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 7-(3,7-dimethyl-5-oxooct-6-enoxy)chromen-2-one.
| Compound Name | 7-(3,7-dimethyl-5-oxooct-6-enoxy)chromen-2-one |
|---|---|
| PubChem CID | 102247134 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 7-(3,7-dimethyl-5-oxooct-6-enoxy)chromen-2-one |
| SMILES | CC(C)=CC(=O)CC(C)CCOc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C19H22O4/c1-13(2)10-16(20)11-14(3)8-9-22-17-6-4-15-5-7-19(21)23-18(15)12-17/h4-7,10,12,14H,8-9,11H2,1-3H3 |
| InChIKey | KPNKXSJZQMNIFW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|