C25H25FO3 — CID 154699172
7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-(4-fluorophenyl)chromen-2-one (PubChem CID 154699172) has the molecular formula C25H25FO3 and a molecular weight of 392.47 g/mol. Its IUPAC name is 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-(4-fluorophenyl)chromen-2-one.
| Compound Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-(4-fluorophenyl)chromen-2-one |
|---|---|
| PubChem CID | 154699172 |
| Molecular Formula | C25H25FO3 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-(4-fluorophenyl)chromen-2-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1ccc2c(-c3ccc(F)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H25FO3/c1-17(2)5-4-6-18(3)13-14-28-21-11-12-22-23(16-25(27)29-24(22)15-21)19-7-9-20(26)10-8-19/h5,7-13,15-16H,4,6,14H2,1-3H3/b18-13+ |
| InChIKey | ZYLGAPYUNVKATB-QGOAFFKASA-N |
| XLogP | 6.67 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|