C19H24O6 — CID 162898481
7-[(2S,6R)-2,6,7-trihydroxy-7-methyl-3-methylideneoctoxy]chromen-2-one (PubChem CID 162898481) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 7-[(2S,6R)-2,6,7-trihydroxy-7-methyl-3-methylideneoctoxy]chromen-2-one.
| Compound Name | 7-[(2S,6R)-2,6,7-trihydroxy-7-methyl-3-methylideneoctoxy]chromen-2-one |
|---|---|
| PubChem CID | 162898481 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 7-[(2S,6R)-2,6,7-trihydroxy-7-methyl-3-methylideneoctoxy]chromen-2-one |
| SMILES | C=C(CC[C@@H](O)C(C)(C)O)[C@H](O)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C19H24O6/c1-12(4-8-17(21)19(2,3)23)15(20)11-24-14-7-5-13-6-9-18(22)25-16(13)10-14/h5-7,9-10,15,17,20-21,23H,1,4,8,11H2,2-3H3/t15-,17-/m1/s1 |
| InChIKey | GOOJJMAKBXRBIG-NVXWUHKLSA-N |
| XLogP | 2.00 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|