C19H18O6 — CID 15463230
7-[2-hydroxy-3-[(4-methyl-5-oxo-2H-furan-2-yl)methyl]but-3-enoxy]chromen-2-one (PubChem CID 15463230) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 7-[2-hydroxy-3-[(4-methyl-5-oxo-2H-furan-2-yl)methyl]but-3-enoxy]chromen-2-one.
| Compound Name | 7-[2-hydroxy-3-[(4-methyl-5-oxo-2H-furan-2-yl)methyl]but-3-enoxy]chromen-2-one |
|---|---|
| PubChem CID | 15463230 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 7-[2-hydroxy-3-[(4-methyl-5-oxo-2H-furan-2-yl)methyl]but-3-enoxy]chromen-2-one |
| SMILES | C=C(CC1C=C(C)C(=O)O1)C(O)COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C19H18O6/c1-11(7-15-8-12(2)19(22)24-15)16(20)10-23-14-5-3-13-4-6-18(21)25-17(13)9-14/h3-6,8-9,15-16,20H,1,7,10H2,2H3 |
| InChIKey | BJAAKPBQJCDTGE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|