C26H32O6 — CID 162899560
[9-hydroxy-3,7,11-trimethyl-1-(2-oxochromen-7-yl)oxydodeca-2,6,10-trien-4-yl] acetate (PubChem CID 162899560) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is [9-hydroxy-3,7,11-trimethyl-1-(2-oxochromen-7-yl)oxydodeca-2,6,10-trien-4-yl] acetate.
| Compound Name | [9-hydroxy-3,7,11-trimethyl-1-(2-oxochromen-7-yl)oxydodeca-2,6,10-trien-4-yl] acetate |
|---|---|
| PubChem CID | 162899560 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [9-hydroxy-3,7,11-trimethyl-1-(2-oxochromen-7-yl)oxydodeca-2,6,10-trien-4-yl] acetate |
| SMILES | CC(=O)OC(CC=C(C)CC(O)C=C(C)C)C(C)=CCOc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C26H32O6/c1-17(2)14-22(28)15-18(3)6-10-24(31-20(5)27)19(4)12-13-30-23-9-7-21-8-11-26(29)32-25(21)16-23/h6-9,11-12,14,16,22,24,28H,10,13,15H2,1-5H3 |
| InChIKey | BFHRBRXUWGCULA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|