C19H22O5 — CID 163189235
6-hydroxy-7-[(2E,5R)-5-hydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one (PubChem CID 163189235) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 6-hydroxy-7-[(2E,5R)-5-hydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one.
| Compound Name | 6-hydroxy-7-[(2E,5R)-5-hydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one |
|---|---|
| PubChem CID | 163189235 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 6-hydroxy-7-[(2E,5R)-5-hydroxy-3,7-dimethylocta-2,6-dienoxy]chromen-2-one |
| SMILES | CC(C)=C[C@H](O)C/C(C)=C/COc1cc2oc(=O)ccc2cc1O |
| InChI | InChI=1S/C19H22O5/c1-12(2)8-15(20)9-13(3)6-7-23-18-11-17-14(10-16(18)21)4-5-19(22)24-17/h4-6,8,10-11,15,20-21H,7,9H2,1-3H3/b13-6+/t15-/m0/s1 |
| InChIKey | RAMCPIBPYJZTNE-NNSJBKGDSA-N |
| XLogP | 3.54 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|