C19H24O6 — CID 162997795
5-[(E,6S)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]-7-hydroxychromen-2-one (PubChem CID 162997795) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 5-[(E,6S)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]-7-hydroxychromen-2-one.
| Compound Name | 5-[(E,6S)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 162997795 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5-[(E,6S)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]-7-hydroxychromen-2-one |
| SMILES | C/C(=C\COc1cc(O)cc2oc(=O)ccc12)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C19H24O6/c1-12(4-6-17(21)19(2,3)23)8-9-24-15-10-13(20)11-16-14(15)5-7-18(22)25-16/h5,7-8,10-11,17,20-21,23H,4,6,9H2,1-3H3/b12-8+/t17-/m0/s1 |
| InChIKey | LMEQTAZUZFIRRZ-UEICXMAYSA-N |
| XLogP | 2.74 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|