C30H38O10 — CID 162933728
[7-[(2E,6E,9S,10R)-9,10-diacetyloxy-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]-2-oxochromen-5-yl] acetate (PubChem CID 162933728) has the molecular formula C30H38O10 and a molecular weight of 558.62 g/mol. Its IUPAC name is [7-[(2E,6E,9S,10R)-9,10-diacetyloxy-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]-2-oxochromen-5-yl] acetate.
| Compound Name | [7-[(2E,6E,9S,10R)-9,10-diacetyloxy-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]-2-oxochromen-5-yl] acetate |
|---|---|
| PubChem CID | 162933728 |
| Molecular Formula | C30H38O10 |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | [7-[(2E,6E,9S,10R)-9,10-diacetyloxy-11-hydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]-2-oxochromen-5-yl] acetate |
| SMILES | CC(=O)Oc1cc(OC/C=C(\C)CC/C=C(\C)C[C@H](OC(C)=O)[C@@H](OC(C)=O)C(C)(C)O)cc2oc(=O)ccc12 |
| InChI | InChI=1S/C30H38O10/c1-18(9-8-10-19(2)15-27(38-21(4)32)29(30(6,7)35)39-22(5)33)13-14-36-23-16-25(37-20(3)31)24-11-12-28(34)40-26(24)17-23/h10-13,16-17,27,29,35H,8-9,14-15H2,1-7H3/b18-13+,19-10+/t27-,29+/m0/s1 |
| InChIKey | LMJUZHBREXNVBR-PYXPKPHASA-N |
| XLogP | 4.79 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|