C23H24O6 — CID 45479858
[(6E)-2,6-dimethyl-8-(7-oxofuro[3,2-g]chromen-4-yl)oxyocta-2,6-dien-4-yl] acetate (PubChem CID 45479858) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is [(6E)-2,6-dimethyl-8-(7-oxofuro[3,2-g]chromen-4-yl)oxyocta-2,6-dien-4-yl] acetate.
| Compound Name | [(6E)-2,6-dimethyl-8-(7-oxofuro[3,2-g]chromen-4-yl)oxyocta-2,6-dien-4-yl] acetate |
|---|---|
| PubChem CID | 45479858 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | [(6E)-2,6-dimethyl-8-(7-oxofuro[3,2-g]chromen-4-yl)oxyocta-2,6-dien-4-yl] acetate |
| SMILES | CC(=O)OC(C=C(C)C)C/C(C)=C/COc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C23H24O6/c1-14(2)11-17(28-16(4)24)12-15(3)7-9-27-23-18-5-6-22(25)29-21(18)13-20-19(23)8-10-26-20/h5-8,10-11,13,17H,9,12H2,1-4H3/b15-7+ |
| InChIKey | MPAAHDIFIFKPLO-VIZOYTHASA-N |
| XLogP | 5.15 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|