C22H24O4 — CID 71307568
4-[(3E)-6-hydroxy-4,8-dimethylnona-3,7-dienyl]furo[3,2-g]chromen-7-one (PubChem CID 71307568) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[(3E)-6-hydroxy-4,8-dimethylnona-3,7-dienyl]furo[3,2-g]chromen-7-one.
| Compound Name | 4-[(3E)-6-hydroxy-4,8-dimethylnona-3,7-dienyl]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 71307568 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 4-[(3E)-6-hydroxy-4,8-dimethylnona-3,7-dienyl]furo[3,2-g]chromen-7-one |
| SMILES | CC(C)=CC(O)C/C(C)=C/CCc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C22H24O4/c1-14(2)11-16(23)12-15(3)5-4-6-17-18-7-8-22(24)26-21(18)13-20-19(17)9-10-25-20/h5,7-11,13,16,23H,4,6,12H2,1-3H3/b15-5+ |
| InChIKey | FBBLYIUMOWEBEF-PJQLUOCWSA-N |
| XLogP | 5.14 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|