C13H8O5 — CID 802311
(7-oxofuro[3,2-g]chromen-4-yl) acetate (PubChem CID 802311) has the molecular formula C13H8O5 and a molecular weight of 244.20 g/mol. Its IUPAC name is (7-oxofuro[3,2-g]chromen-4-yl) acetate.
| Compound Name | (7-oxofuro[3,2-g]chromen-4-yl) acetate |
|---|---|
| PubChem CID | 802311 |
| Molecular Formula | C13H8O5 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | (7-oxofuro[3,2-g]chromen-4-yl) acetate |
| SMILES | CC(=O)Oc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C13H8O5/c1-7(14)17-13-8-2-3-12(15)18-11(8)6-10-9(13)4-5-16-10/h2-6H,1H3 |
| InChIKey | AZRCRZRFGJXBFW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|