C23H22O8 — CID 163060127
[(6S)-2,2,6-trimethyl-5-oxo-6-[2-(7-oxofuro[3,2-g]chromen-4-yl)oxyethyl]pyran-3-yl] acetate (PubChem CID 163060127) has the molecular formula C23H22O8 and a molecular weight of 426.42 g/mol. Its IUPAC name is [(6S)-2,2,6-trimethyl-5-oxo-6-[2-(7-oxofuro[3,2-g]chromen-4-yl)oxyethyl]pyran-3-yl] acetate.
| Compound Name | [(6S)-2,2,6-trimethyl-5-oxo-6-[2-(7-oxofuro[3,2-g]chromen-4-yl)oxyethyl]pyran-3-yl] acetate |
|---|---|
| PubChem CID | 163060127 |
| Molecular Formula | C23H22O8 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | [(6S)-2,2,6-trimethyl-5-oxo-6-[2-(7-oxofuro[3,2-g]chromen-4-yl)oxyethyl]pyran-3-yl] acetate |
| SMILES | CC(=O)OC1=CC(=O)[C@](C)(CCOc2c3ccoc3cc3oc(=O)ccc23)OC1(C)C |
| InChI | InChI=1S/C23H22O8/c1-13(24)29-19-12-18(25)23(4,31-22(19,2)3)8-10-28-21-14-5-6-20(26)30-17(14)11-16-15(21)7-9-27-16/h5-7,9,11-12H,8,10H2,1-4H3/t23-/m0/s1 |
| InChIKey | CVFIQCYQDHTEJM-QHCPKHFHSA-N |
| XLogP | 3.89 |
| TPSA | 105.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|