C23H25FO5 — CID 143214032
ethane;4-[3-(4-fluorocyclohepta-1,3-dien-1-yl)oxypropoxy]furo[3,2-g]chromen-7-one (PubChem CID 143214032) has the molecular formula C23H25FO5 and a molecular weight of 400.45 g/mol. Its IUPAC name is ethane;4-[3-(4-fluorocyclohepta-1,3-dien-1-yl)oxypropoxy]furo[3,2-g]chromen-7-one.
| Compound Name | ethane;4-[3-(4-fluorocyclohepta-1,3-dien-1-yl)oxypropoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 143214032 |
| Molecular Formula | C23H25FO5 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | ethane;4-[3-(4-fluorocyclohepta-1,3-dien-1-yl)oxypropoxy]furo[3,2-g]chromen-7-one |
| SMILES | CC.O=c1ccc2c(OCCCOC3=CC=C(F)CCC3)c3ccoc3cc2o1 |
| InChI | InChI=1S/C21H19FO5.C2H6/c22-14-3-1-4-15(6-5-14)24-10-2-11-26-21-16-7-8-20(23)27-19(16)13-18-17(21)9-12-25-18;1-2/h5-9,12-13H,1-4,10-11H2;1-2H3 |
| InChIKey | PWJISAMMMNDRDL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|