C20H15FO5 — CID 11717338
4-[3-(4-fluorophenoxy)propoxy]furo[3,2-g]chromen-7-one (PubChem CID 11717338) has the molecular formula C20H15FO5 and a molecular weight of 354.33 g/mol. Its IUPAC name is 4-[3-(4-fluorophenoxy)propoxy]furo[3,2-g]chromen-7-one.
| Compound Name | 4-[3-(4-fluorophenoxy)propoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 11717338 |
| Molecular Formula | C20H15FO5 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-[3-(4-fluorophenoxy)propoxy]furo[3,2-g]chromen-7-one |
| SMILES | O=c1ccc2c(OCCCOc3ccc(F)cc3)c3ccoc3cc2o1 |
| InChI | InChI=1S/C20H15FO5/c21-13-2-4-14(5-3-13)23-9-1-10-25-20-15-6-7-19(22)26-18(15)12-17-16(20)8-11-24-17/h2-8,11-12H,1,9-10H2 |
| InChIKey | BFYXFUBEFMDHHQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|