C18H18O7 — CID 162940098
[3-hydroxy-2-methyl-4-(7-oxofuro[3,2-g]chromen-4-yl)oxybutan-2-yl] acetate (PubChem CID 162940098) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is [3-hydroxy-2-methyl-4-(7-oxofuro[3,2-g]chromen-4-yl)oxybutan-2-yl] acetate.
| Compound Name | [3-hydroxy-2-methyl-4-(7-oxofuro[3,2-g]chromen-4-yl)oxybutan-2-yl] acetate |
|---|---|
| PubChem CID | 162940098 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [3-hydroxy-2-methyl-4-(7-oxofuro[3,2-g]chromen-4-yl)oxybutan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)C(O)COc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C18H18O7/c1-10(19)25-18(2,3)15(20)9-23-17-11-4-5-16(21)24-14(11)8-13-12(17)6-7-22-13/h4-8,15,20H,9H2,1-3H3 |
| InChIKey | CBXPWAIJBALCRV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|