C21H22O9 — CID 162956678
(4S,6R,7R)-4,6,7-trihydroxy-2,6-dimethyl-8-(7-oxofuro[3,2-g]chromen-4-yl)oxyoct-2-enoic acid (PubChem CID 162956678) has the molecular formula C21H22O9 and a molecular weight of 418.40 g/mol. Its IUPAC name is (4S,6R,7R)-4,6,7-trihydroxy-2,6-dimethyl-8-(7-oxofuro[3,2-g]chromen-4-yl)oxyoct-2-enoic acid.
| Compound Name | (4S,6R,7R)-4,6,7-trihydroxy-2,6-dimethyl-8-(7-oxofuro[3,2-g]chromen-4-yl)oxyoct-2-enoic acid |
|---|---|
| PubChem CID | 162956678 |
| Molecular Formula | C21H22O9 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (4S,6R,7R)-4,6,7-trihydroxy-2,6-dimethyl-8-(7-oxofuro[3,2-g]chromen-4-yl)oxyoct-2-enoic acid |
| SMILES | CC(=C[C@@H](O)C[C@@](C)(O)[C@H](O)COc1c2ccoc2cc2oc(=O)ccc12)C(=O)O |
| InChI | InChI=1S/C21H22O9/c1-11(20(25)26)7-12(22)9-21(2,27)17(23)10-29-19-13-3-4-18(24)30-16(13)8-15-14(19)5-6-28-15/h3-8,12,17,22-23,27H,9-10H2,1-2H3,(H,25,26)/t12-,17-,21-/m1/s1 |
| InChIKey | WYBYWLAOBATXAF-LAECCNGNSA-N |
| XLogP | 1.81 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|