C21H24O7 — CID 11646755
4-[(2S)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]ethoxy]furo[3,2-g]chromen-7-one (PubChem CID 11646755) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 4-[(2S)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]ethoxy]furo[3,2-g]chromen-7-one.
| Compound Name | 4-[(2S)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]ethoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 11646755 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-[(2S)-2-hydroxy-2-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]ethoxy]furo[3,2-g]chromen-7-one |
| SMILES | CC(C)(O)[C@@H]1CC[C@](C)([C@@H](O)COc2c3ccoc3cc3oc(=O)ccc23)O1 |
| InChI | InChI=1S/C21H24O7/c1-20(2,24)17-6-8-21(3,28-17)16(22)11-26-19-12-4-5-18(23)27-15(12)10-14-13(19)7-9-25-14/h4-5,7,9-10,16-17,22,24H,6,8,11H2,1-3H3/t16-,17-,21+/m0/s1 |
| InChIKey | URTUKYUOMNRDDS-XGHQBKJUSA-N |
| XLogP | 2.99 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|