About 4-propoxyfuro[3,2-g]chromen-7-one
4-propoxyfuro[3,2-g]chromen-7-one (PubChem CID 86101667) has the molecular formula C14H12O4
and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-propoxyfuro[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 4-propoxyfuro[3,2-g]chromen-7-one |
| PubChem CID | 86101667 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 4-propoxyfuro[3,2-g]chromen-7-one |
| SMILES | CCCOc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C14H12O4/c1-2-6-17-14-9-3-4-13(15)18-12(9)8-11-10(14)5-7-16-11/h3-5,7-8H,2,6H2,1H3 |
| InChIKey | IISLPJKQGLNWNI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-propoxyfuro[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propoxyfuro[3,2-g]chromen-7-one?
The IUPAC name of 4-propoxyfuro[3,2-g]chromen-7-one (CID 86101667) is 4-propoxyfuro[3,2-g]chromen-7-one.
What is the SMILES notation for 4-propoxyfuro[3,2-g]chromen-7-one?
The canonical SMILES for 4-propoxyfuro[3,2-g]chromen-7-one is CCCOc1c2ccoc2cc2oc(=O)ccc12.
What is the InChIKey of 4-propoxyfuro[3,2-g]chromen-7-one?
The InChIKey is IISLPJKQGLNWNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4/c1-2-6-17-14-9-3-4-13(15)18-12(9)8-11-10(14)5-7-16-11/h3-5,7-8H,2,6H2,1H3.
What are the key properties of 4-propoxyfuro[3,2-g]chromen-7-one?
4-propoxyfuro[3,2-g]chromen-7-one has a molecular weight of 244.25 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propoxyfuro[3,2-g]chromen-7-one is sourced from PubChem (CID 86101667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).