C21H16O5 — CID 11588292
4-(3-oxo-4-phenylbutoxy)furo[3,2-g]chromen-7-one (PubChem CID 11588292) has the molecular formula C21H16O5 and a molecular weight of 348.35 g/mol. Its IUPAC name is 4-(3-oxo-4-phenylbutoxy)furo[3,2-g]chromen-7-one.
| Compound Name | 4-(3-oxo-4-phenylbutoxy)furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 11588292 |
| Molecular Formula | C21H16O5 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-(3-oxo-4-phenylbutoxy)furo[3,2-g]chromen-7-one |
| SMILES | O=C(CCOc1c2ccoc2cc2oc(=O)ccc12)Cc1ccccc1 |
| InChI | InChI=1S/C21H16O5/c22-15(12-14-4-2-1-3-5-14)8-10-25-21-16-6-7-20(23)26-19(16)13-18-17(21)9-11-24-18/h1-7,9,11,13H,8,10,12H2 |
| InChIKey | JMPLIYPZQMULPB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|