C14H8O5 — CID 170648815
(7-oxofuro[3,2-g]chromen-4-yl) prop-2-enoate (PubChem CID 170648815) has the molecular formula C14H8O5 and a molecular weight of 256.21 g/mol. Its IUPAC name is (7-oxofuro[3,2-g]chromen-4-yl) prop-2-enoate.
| Compound Name | (7-oxofuro[3,2-g]chromen-4-yl) prop-2-enoate |
|---|---|
| PubChem CID | 170648815 |
| Molecular Formula | C14H8O5 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | (7-oxofuro[3,2-g]chromen-4-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C14H8O5/c1-2-12(15)19-14-8-3-4-13(16)18-11(8)7-10-9(14)5-6-17-10/h2-7H,1H2 |
| InChIKey | HTZAMGPNURSLCU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|