C14H11NO5 — CID 170648795
(7-oxofuro[3,2-g]chromen-4-yl) N,N-dimethylcarbamate (PubChem CID 170648795) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is (7-oxofuro[3,2-g]chromen-4-yl) N,N-dimethylcarbamate.
| Compound Name | (7-oxofuro[3,2-g]chromen-4-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 170648795 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (7-oxofuro[3,2-g]chromen-4-yl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C14H11NO5/c1-15(2)14(17)20-13-8-3-4-12(16)19-11(8)7-10-9(13)5-6-18-10/h3-7H,1-2H3 |
| InChIKey | MKZBYYHLZJYMPS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|