C21H26O9 — CID 162987520
4-[(2S)-2,3-dihydroxy-3-methylbutoxy]-9-[(2R)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one (PubChem CID 162987520) has the molecular formula C21H26O9 and a molecular weight of 422.43 g/mol. Its IUPAC name is 4-[(2S)-2,3-dihydroxy-3-methylbutoxy]-9-[(2R)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one.
| Compound Name | 4-[(2S)-2,3-dihydroxy-3-methylbutoxy]-9-[(2R)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 162987520 |
| Molecular Formula | C21H26O9 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-[(2S)-2,3-dihydroxy-3-methylbutoxy]-9-[(2R)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one |
| SMILES | CC(C)(O)[C@H](O)COc1c2occc2c(OC[C@H](O)C(C)(C)O)c2ccc(=O)oc12 |
| InChI | InChI=1S/C21H26O9/c1-20(2,25)13(22)9-28-16-11-5-6-15(24)30-18(11)19(17-12(16)7-8-27-17)29-10-14(23)21(3,4)26/h5-8,13-14,22-23,25-26H,9-10H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | KWEVWSFHZRLPIY-UONOGXRCSA-N |
| XLogP | 1.56 |
| TPSA | 142.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|