C18H20O7 — CID 102165492
4-(2-hydroxy-3-methoxy-3-methylbutoxy)-9-methoxyfuro[3,2-g]chromen-7-one (PubChem CID 102165492) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is 4-(2-hydroxy-3-methoxy-3-methylbutoxy)-9-methoxyfuro[3,2-g]chromen-7-one.
| Compound Name | 4-(2-hydroxy-3-methoxy-3-methylbutoxy)-9-methoxyfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 102165492 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-(2-hydroxy-3-methoxy-3-methylbutoxy)-9-methoxyfuro[3,2-g]chromen-7-one |
| SMILES | COc1c2occc2c(OCC(O)C(C)(C)OC)c2ccc(=O)oc12 |
| InChI | InChI=1S/C18H20O7/c1-18(2,22-4)12(19)9-24-14-10-5-6-13(20)25-16(10)17(21-3)15-11(14)7-8-23-15/h5-8,12,19H,9H2,1-4H3 |
| InChIKey | FDELMZACGNNYPY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|