C17H18O7 — CID 171382402
9-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-(trideuteriomethoxy)furo[3,2-g]chromen-7-one (PubChem CID 171382402) has the molecular formula C17H18O7 and a molecular weight of 337.34 g/mol. Its IUPAC name is 9-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-(trideuteriomethoxy)furo[3,2-g]chromen-7-one.
| Compound Name | 9-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-(trideuteriomethoxy)furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 171382402 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 9-[(2R)-2,3-dihydroxy-3-methylbutoxy]-4-(trideuteriomethoxy)furo[3,2-g]chromen-7-one |
| SMILES | [2H]C([2H])([2H])Oc1c2ccoc2c(OC[C@@H](O)C(C)(C)O)c2oc(=O)ccc12 |
| InChI | InChI=1S/C17H18O7/c1-17(2,20)11(18)8-23-16-14-10(6-7-22-14)13(21-3)9-4-5-12(19)24-15(9)16/h4-7,11,18,20H,8H2,1-3H3/t11-/m1/s1/i3D3 |
| InChIKey | PKRPFNXROFUNDE-LMUHODJSSA-N |
| XLogP | 2.06 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|