C32H30O11 — CID 10769724
9-[[(2S,4R)-9'-[(2R)-2,3-dihydroxy-3-methylbutoxy]-5,5-dimethylspiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]methoxy]furo[3,2-g]chromen-7-one (PubChem CID 10769724) has the molecular formula C32H30O11 and a molecular weight of 590.58 g/mol. Its IUPAC name is 9-[[(2S,4R)-9'-[(2R)-2,3-dihydroxy-3-methylbutoxy]-5,5-dimethylspiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]methoxy]furo[3,2-g]chromen-7-one.
| Compound Name | 9-[[(2S,4R)-9'-[(2R)-2,3-dihydroxy-3-methylbutoxy]-5,5-dimethylspiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]methoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 10769724 |
| Molecular Formula | C32H30O11 |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | 9-[[(2S,4R)-9'-[(2R)-2,3-dihydroxy-3-methylbutoxy]-5,5-dimethylspiro[1,3-dioxolane-2,7'-furo[3,2-g]chromene]-4-yl]methoxy]furo[3,2-g]chromen-7-one |
| SMILES | CC(C)(O)[C@H](O)COc1c2c(cc3ccoc13)C=C[C@]1(O2)O[C@H](COc2c3occc3cc3ccc(=O)oc23)C(C)(C)O1 |
| InChI | InChI=1S/C32H30O11/c1-30(2,35)21(33)15-38-29-25-20(9-12-37-25)14-18-7-10-32(42-27(18)29)41-22(31(3,4)43-32)16-39-28-24-19(8-11-36-24)13-17-5-6-23(34)40-26(17)28/h5-14,21-22,33,35H,15-16H2,1-4H3/t21-,22-,32-/m1/s1 |
| InChIKey | RQSPCDMBNUXDLD-VOSQCMCKSA-N |
| XLogP | 5.13 |
| TPSA | 143.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|