C17H16O5 — CID 163032270
9-[[(2S)-2,3,3-trimethyloxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one (PubChem CID 163032270) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 9-[[(2S)-2,3,3-trimethyloxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one.
| Compound Name | 9-[[(2S)-2,3,3-trimethyloxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 163032270 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 9-[[(2S)-2,3,3-trimethyloxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one |
| SMILES | CC1(C)O[C@@]1(C)COc1c2occc2cc2ccc(=O)oc12 |
| InChI | InChI=1S/C17H16O5/c1-16(2)17(3,22-16)9-20-15-13-11(6-7-19-13)8-10-4-5-12(18)21-14(10)15/h4-8H,9H2,1-3H3/t17-/m0/s1 |
| InChIKey | NDPZCOJCTVAHIB-KRWDZBQOSA-N |
| XLogP | 3.49 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|