C21H18O7 — CID 26123114
9-[[(2R,3S)-3-methyl-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]methyl]oxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one (PubChem CID 26123114) has the molecular formula C21H18O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is 9-[[(2R,3S)-3-methyl-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]methyl]oxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one.
| Compound Name | 9-[[(2R,3S)-3-methyl-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]methyl]oxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 26123114 |
| Molecular Formula | C21H18O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 9-[[(2R,3S)-3-methyl-3-[[(2S)-4-methyl-5-oxo-2H-furan-2-yl]methyl]oxiran-2-yl]methoxy]furo[3,2-g]chromen-7-one |
| SMILES | CC1=C[C@H](C[C@]2(C)O[C@@H]2COc2c3occc3cc3ccc(=O)oc23)OC1=O |
| InChI | InChI=1S/C21H18O7/c1-11-7-14(26-20(11)23)9-21(2)15(28-21)10-25-19-17-13(5-6-24-17)8-12-3-4-16(22)27-18(12)19/h3-8,14-15H,9-10H2,1-2H3/t14-,15-,21+/m1/s1 |
| InChIKey | CISFAPDYRQPRCZ-PZPWOCDFSA-N |
| XLogP | 3.34 |
| TPSA | 91.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|