C16H18O6 — CID 163041261
7-[[(2R)-3,3-dimethyloxiran-2-yl]methoxy]-6,8-dimethoxychromen-2-one (PubChem CID 163041261) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is 7-[[(2R)-3,3-dimethyloxiran-2-yl]methoxy]-6,8-dimethoxychromen-2-one.
| Compound Name | 7-[[(2R)-3,3-dimethyloxiran-2-yl]methoxy]-6,8-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 163041261 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 7-[[(2R)-3,3-dimethyloxiran-2-yl]methoxy]-6,8-dimethoxychromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2c(OC)c1OC[C@H]1OC1(C)C |
| InChI | InChI=1S/C16H18O6/c1-16(2)11(22-16)8-20-14-10(18-3)7-9-5-6-12(17)21-13(9)15(14)19-4/h5-7,11H,8H2,1-4H3/t11-/m1/s1 |
| InChIKey | ZJHAMRQWRXSFLI-LLVKDONJSA-N |
| XLogP | 2.37 |
| TPSA | 70.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|