C21H26O5 — CID 170982258
6,8-dimethoxy-7-[(3E,7E)-2-methylnona-3,7-dien-2-yl]oxychromen-2-one (PubChem CID 170982258) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is 6,8-dimethoxy-7-[(3E,7E)-2-methylnona-3,7-dien-2-yl]oxychromen-2-one.
| Compound Name | 6,8-dimethoxy-7-[(3E,7E)-2-methylnona-3,7-dien-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 170982258 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 6,8-dimethoxy-7-[(3E,7E)-2-methylnona-3,7-dien-2-yl]oxychromen-2-one |
| SMILES | C/C=C/CC/C=C/C(C)(C)Oc1c(OC)cc2ccc(=O)oc2c1OC |
| InChI | InChI=1S/C21H26O5/c1-6-7-8-9-10-13-21(2,3)26-19-16(23-4)14-15-11-12-17(22)25-18(15)20(19)24-5/h6-7,10-14H,8-9H2,1-5H3/b7-6+,13-10+ |
| InChIKey | DTHDVEMSWAGMKQ-FCXQYMQBSA-N |
| XLogP | 4.88 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|