C11H9NO6 — CID 134989897
6,8-dimethoxy-7-nitrochromen-2-one (PubChem CID 134989897) has the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. Its IUPAC name is 6,8-dimethoxy-7-nitrochromen-2-one.
| Compound Name | 6,8-dimethoxy-7-nitrochromen-2-one |
|---|---|
| PubChem CID | 134989897 |
| Molecular Formula | C11H9NO6 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 6,8-dimethoxy-7-nitrochromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9NO6/c1-16-7-5-6-3-4-8(13)18-10(6)11(17-2)9(7)12(14)15/h3-5H,1-2H3 |
| InChIKey | NQGPUIUMSPXGGZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 91.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|