C12H8O3S — CID 14235198
6-methoxythieno[2,3-h]chromen-2-one (PubChem CID 14235198) has the molecular formula C12H8O3S and a molecular weight of 232.26 g/mol. Its IUPAC name is 6-methoxythieno[2,3-h]chromen-2-one.
| Compound Name | 6-methoxythieno[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 14235198 |
| Molecular Formula | C12H8O3S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 6-methoxythieno[2,3-h]chromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2c2ccsc12 |
| InChI | InChI=1S/C12H8O3S/c1-14-9-6-7-2-3-10(13)15-11(7)8-4-5-16-12(8)9/h2-6H,1H3 |
| InChIKey | BYULGPLPSNZQIT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|