C10H10O2S — CID 11095506
4,7-dimethoxy-1-benzothiophene (PubChem CID 11095506) has the molecular formula C10H10O2S and a molecular weight of 194.25 g/mol. Its IUPAC name is 4,7-dimethoxy-1-benzothiophene.
| Compound Name | 4,7-dimethoxy-1-benzothiophene |
|---|---|
| PubChem CID | 11095506 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 4,7-dimethoxy-1-benzothiophene |
| SMILES | COc1ccc(OC)c2sccc12 |
| InChI | InChI=1S/C10H10O2S/c1-11-8-3-4-9(12-2)10-7(8)5-6-13-10/h3-6H,1-2H3 |
| InChIKey | NCNWCNXPSWANMM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |