C10H9BrO2S — CID 130914431
5-bromo-4,7-dimethoxy-1-benzothiophene (PubChem CID 130914431) has the molecular formula C10H9BrO2S and a molecular weight of 273.15 g/mol. Its IUPAC name is 5-bromo-4,7-dimethoxy-1-benzothiophene.
| Compound Name | 5-bromo-4,7-dimethoxy-1-benzothiophene |
|---|---|
| PubChem CID | 130914431 |
| Molecular Formula | C10H9BrO2S |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | 5-bromo-4,7-dimethoxy-1-benzothiophene |
| SMILES | COc1c(Br)cc(OC)c2sccc12 |
| InChI | InChI=1S/C10H9BrO2S/c1-12-8-5-7(11)9(13-2)6-3-4-14-10(6)8/h3-5H,1-2H3 |
| InChIKey | XHAAGEIDCGOCIE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |