C9H6Br2OS — CID 130926286
4,5-dibromo-7-methoxy-1-benzothiophene (PubChem CID 130926286) has the molecular formula C9H6Br2OS and a molecular weight of 322.02 g/mol. Its IUPAC name is 4,5-dibromo-7-methoxy-1-benzothiophene.
| Compound Name | 4,5-dibromo-7-methoxy-1-benzothiophene |
|---|---|
| PubChem CID | 130926286 |
| Molecular Formula | C9H6Br2OS |
| Molecular Weight | 322.02 g/mol |
| Exact Mass | 319.85 |
| IUPAC Name | 4,5-dibromo-7-methoxy-1-benzothiophene |
| SMILES | COc1cc(Br)c(Br)c2ccsc12 |
| InChI | InChI=1S/C9H6Br2OS/c1-12-7-4-6(10)8(11)5-2-3-13-9(5)7/h2-4H,1H3 |
| InChIKey | KZJZMJGXAYMJLA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.02 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |