C8H4Br2S2 — CID 130926470
4,7-dibromo-1-benzothiophene-5-thiol (PubChem CID 130926470) has the molecular formula C8H4Br2S2 and a molecular weight of 324.06 g/mol. Its IUPAC name is 4,7-dibromo-1-benzothiophene-5-thiol.
| Compound Name | 4,7-dibromo-1-benzothiophene-5-thiol |
|---|---|
| PubChem CID | 130926470 |
| Molecular Formula | C8H4Br2S2 |
| Molecular Weight | 324.06 g/mol |
| Exact Mass | 321.81 |
| IUPAC Name | 4,7-dibromo-1-benzothiophene-5-thiol |
| SMILES | Sc1cc(Br)c2sccc2c1Br |
| InChI | InChI=1S/C8H4Br2S2/c9-5-3-6(11)7(10)4-1-2-12-8(4)5/h1-3,11H |
| InChIKey | MEXUERKXMWQARM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.06 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|