C9H4Br2OS — CID 130914405
4,7-dibromo-1-benzothiophene-5-carbaldehyde (PubChem CID 130914405) has the molecular formula C9H4Br2OS and a molecular weight of 320.00 g/mol. Its IUPAC name is 4,7-dibromo-1-benzothiophene-5-carbaldehyde.
| Compound Name | 4,7-dibromo-1-benzothiophene-5-carbaldehyde |
|---|---|
| PubChem CID | 130914405 |
| Molecular Formula | C9H4Br2OS |
| Molecular Weight | 320.00 g/mol |
| Exact Mass | 317.83 |
| IUPAC Name | 4,7-dibromo-1-benzothiophene-5-carbaldehyde |
| SMILES | O=Cc1cc(Br)c2sccc2c1Br |
| InChI | InChI=1S/C9H4Br2OS/c10-7-3-5(4-12)8(11)6-1-2-13-9(6)7/h1-4H |
| InChIKey | PHANNXKGRJVQKF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.00 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|