C11H8O2S2 — CID 144770940
4-methoxythieno[2,3-f][1]benzothiol-8-ol (PubChem CID 144770940) has the molecular formula C11H8O2S2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 4-methoxythieno[2,3-f][1]benzothiol-8-ol.
| Compound Name | 4-methoxythieno[2,3-f][1]benzothiol-8-ol |
|---|---|
| PubChem CID | 144770940 |
| Molecular Formula | C11H8O2S2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 4-methoxythieno[2,3-f][1]benzothiol-8-ol |
| SMILES | COc1c2ccsc2c(O)c2ccsc12 |
| InChI | InChI=1S/C11H8O2S2/c1-13-9-7-3-5-14-10(7)8(12)6-2-4-15-11(6)9/h2-5,12H,1H3 |
| InChIKey | ACMVVOTXDMHCEV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |