C12H13NO3S — CID 117381131
3-amino-3-(7-methoxy-1-benzothiophen-4-yl)propanoic acid (PubChem CID 117381131) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-amino-3-(7-methoxy-1-benzothiophen-4-yl)propanoic acid.
| Compound Name | 3-amino-3-(7-methoxy-1-benzothiophen-4-yl)propanoic acid |
|---|---|
| PubChem CID | 117381131 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-amino-3-(7-methoxy-1-benzothiophen-4-yl)propanoic acid |
| SMILES | COc1ccc(C(N)CC(=O)O)c2ccsc12 |
| InChI | InChI=1S/C12H13NO3S/c1-16-10-3-2-7(9(13)6-11(14)15)8-4-5-17-12(8)10/h2-5,9H,6,13H2,1H3,(H,14,15) |
| InChIKey | DIBOHOWDQLPJHE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |