C12H17NO3 — CID 117319634
3-amino-3-(3-methoxy-2,4-dimethylphenyl)propanoic acid (PubChem CID 117319634) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-amino-3-(3-methoxy-2,4-dimethylphenyl)propanoic acid.
| Compound Name | 3-amino-3-(3-methoxy-2,4-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117319634 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-amino-3-(3-methoxy-2,4-dimethylphenyl)propanoic acid |
| SMILES | COc1c(C)ccc(C(N)CC(=O)O)c1C |
| InChI | InChI=1S/C12H17NO3/c1-7-4-5-9(8(2)12(7)16-3)10(13)6-11(14)15/h4-5,10H,6,13H2,1-3H3,(H,14,15) |
| InChIKey | GZIQZXMTKKYQKY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |